1-hydroxy-2-unsubstituted benzenoids
eMolecules 71597-85-8 | (4-hydroxyphenyl)boronic acid | Synthonix | MFCD01074628 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccc(O)cc1 | 250g | 808576046
(4-hydroxyphenyl)boronic acid | Synthonix | 71597-85-8 | MFCD01074628 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccc(O)cc1 | 250g | 808576046
eMolecules 89466-08-0 | 2-Hydroxyphenylboronic acid | ChemScene | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 10g | 346749858
2-Hydroxyphenylboronic acid | ChemScene | 89466-08-0 | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 10g | 346749858
eMolecules 579-58-8 | N-(4-Hydroxyphenyl)-N-methylacetamide | Combi-Blocks, Inc. | MFCD00872063 | 165.192 | C9H11NO2 | 97.000 | CN(C(C)=O)c1ccc(O)cc1 | 1g | 603133517
N-(4-Hydroxyphenyl)-N-methylacetamide | Combi-Blocks, Inc. | 579-58-8 | MFCD00872063 | 165.192 | C9H11NO2 | 97.000 | CN(C(C)=O)c1ccc(O)cc1 | 1g | 603133517
Matrix Scientific ETHYL 4-HYDROXYPHENYLACETAT-25
Ethyl 4-hydroxyphenylacetate Mf C10h12o3 Mw 180.21 Cas 17138-28-2 Mdl MFCD00016491
Medchemexpress LLC 4-hydroxybenzoic acid | 99-96-7 | MFCD00002547 | 100.0% | 138.12 | C7H6O3 | 1mL
4-Hydroxybenzoic acid a phenolic derivative of benzoic acid could inhibit most gram-positive and some gram-negative bacteria with an IC50 of 160 g/mL
Medchemexpress LLC 4-hydroxyphenyl diphenyl phosphate | 56806-74-7 | MFCD30529787 | 342.28 g/mol | C18H15O5P | 25 MG
4-Hydroxyphenyl diphenyl phosphate is a hydroxylated metabolite of organophosphate flame retardants provided as a research chemical for studies of metabolism, environmental fate, and toxicology. It is used as an analytical reference and test compound in method development and quantitation of flame retardant metabolites.
- Used as a metabolite reference in environmental and toxicology studies.
- Suitable for analytical method development and quantitation.
- Molecular formula C18H15O5P and molecular weight 342.28 g/mol.
- Cataloged under CAS number 56806-74-7 for unambiguous identification.
- Available in small research quantities (for example, 25 mg).
- Intended for research use only; not for human or diagnostic use.
eMolecules 893736-72-6 | 2'-Hydroxybiphenyl-3-carboxylic acid | Combi-Blocks | MFCD06802571 | 214.220 | C13H10O3 | 98.000 | OC(=O)c1cccc(c1)-c1ccccc1O | 1g | 117528336
2'-Hydroxybiphenyl-3-carboxylic acid | Combi-Blocks | 893736-72-6 | MFCD06802571 | 214.220 | C13H10O3 | 98.000 | OC(=O)c1cccc(c1)-c1ccccc1O | 1g | 117528336
eMolecules 611-62-1 | 4-(2-Hydroxyphenyl)phenol | Combi-Blocks | MFCD11895228 | 186.210 | C12H10O2 | 98.000 | Oc1ccc(cc1)-c1ccccc1O | 1g | 117577907
4-(2-Hydroxyphenyl)phenol | Combi-Blocks | 611-62-1 | MFCD11895228 | 186.210 | C12H10O2 | 98.000 | Oc1ccc(cc1)-c1ccccc1O | 1g | 117577907
eMolecules 16357-40-7 | 3-Acetyl-4-hydroxybenzoic acid | Combi-Blocks | MFCD00532680 | 180.159 | C9H8O4 | 95.000 | CC(=O)c1cc(ccc1O)C(O)=O | 1g | 528672123
3-Acetyl-4-hydroxybenzoic acid | Combi-Blocks | 16357-40-7 | MFCD00532680 | 180.159 | C9H8O4 | 95.000 | CC(=O)c1cc(ccc1O)C(O)=O | 1g | 528672123
Medchemexpress LLC 2-Hydroxybenzonitrile | 611-20-1 | 99.99% | 119.12 | 25 G
2-Hydroxybenzonitrile is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
- Biochemical reagent
- Biological material
- Organic compound for life science research
- Solid appearance
- Off-white to light yellow color
Sigma Aldrich Fine Chemicals Biosciences N-Boc-tyramine 97% | 64318-28-1 | MFCD05864730 | 5G
N-Boc-tyramine 97% | Purity: 97% | Mol Wt: 237.29 | 64318-28-1 | MFCD05864730 | 5G
eMolecules 128161-59-1 | 3-Chloro-4-hydroxybenzoic acid hemihydrate | Combi-Blocks, Inc. | MFCD02662353 | 363.140 | C14H12Cl2O7 | 98.000 | O.OC(=O)c1ccc(O)c(Cl)c1.OC(=O)c1ccc(O)c(Cl)c1 | 25g | 603144835
3-Chloro-4-hydroxybenzoic acid hemihydrate | Combi-Blocks, Inc. | 128161-59-1 | MFCD02662353 | 363.140 | C14H12Cl2O7 | 98.000 | O.OC(=O)c1ccc(O)c(Cl)c1.OC(=O)c1ccc(O)c(Cl)c1 | 25g | 603144835
Medchemexpress LLC Benzoic acid, 4-hydroxy-13c | 146672-02-8 | 99.2% | 139.11 | C613CH6O3 | 1mg
4-Hydroxybenzoic acid-13C is the 13C labeled 4-Hydroxybenzoic acid[1] 4-Hydroxybenzoic acid a phenolic derivative of benzoic acid could inhibit most gram-positive and some gram-negative bacteria with an IC50 of 160 g/mL[2]
Chemscene ChemScene | 4-Hydroxyphthalic acid | 10G | CS-D0572 | 0.98 | 610-35-5| MFCD00013984 | 182.13
ChemScene | 4-Hydroxyphthalic acid | 10G | CS-D0572 | 0.98 | 610-35-5| MFCD00013984 | 182.13
eMolecules 336882-80-5 | 4-(2-Hydroxyphenyl)Piperidin-4-Ol | MFCD20483788 | 250mg
ChemScene | (S)-2-(((tert-Butoxycarbonyl)amino)methyl)-4-methylpentanoic acid | 100mg | 572256307 | CS-0038055 | 828254-18-8 | MFCD07372886 | 245.319 | C12H23NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>